C12H9N3OS — CID 166321044
N-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide (PubChem CID 166321044) has the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. Its IUPAC name is N-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide.
| Compound Name | N-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 166321044 |
| Molecular Formula | C12H9N3OS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | N-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccsc1)c1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C12H9N3OS/c16-12(15-8-3-6-17-7-8)10-2-5-14-11-9(10)1-4-13-11/h1-7H,(H,13,14)(H,15,16) |
| InChIKey | ZWSOPGIGCLZKRA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |