C17H15BrClN3 — CID 166321942
5-bromo-N-[1-(3-chlorophenyl)propan-2-yl]quinazolin-2-amine (PubChem CID 166321942) has the molecular formula C17H15BrClN3 and a molecular weight of 376.69 g/mol. Its IUPAC name is 5-bromo-N-[1-(3-chlorophenyl)propan-2-yl]quinazolin-2-amine.
| Compound Name | 5-bromo-N-[1-(3-chlorophenyl)propan-2-yl]quinazolin-2-amine |
|---|---|
| PubChem CID | 166321942 |
| Molecular Formula | C17H15BrClN3 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 5-bromo-N-[1-(3-chlorophenyl)propan-2-yl]quinazolin-2-amine |
| SMILES | CC(Cc1cccc(Cl)c1)Nc1ncc2c(Br)cccc2n1 |
| InChI | InChI=1S/C17H15BrClN3/c1-11(8-12-4-2-5-13(19)9-12)21-17-20-10-14-15(18)6-3-7-16(14)22-17/h2-7,9-11H,8H2,1H3,(H,20,21,22) |
| InChIKey | GQTPOEVLHUKAEU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |