C19H18Cl2N2O — CID 167797323
3-chloro-N-[1-(3-chlorophenyl)propan-2-yl]-6-methoxyisoquinolin-1-amine (PubChem CID 167797323) has the molecular formula C19H18Cl2N2O and a molecular weight of 361.27 g/mol. Its IUPAC name is 3-chloro-N-[1-(3-chlorophenyl)propan-2-yl]-6-methoxyisoquinolin-1-amine.
| Compound Name | 3-chloro-N-[1-(3-chlorophenyl)propan-2-yl]-6-methoxyisoquinolin-1-amine |
|---|---|
| PubChem CID | 167797323 |
| Molecular Formula | C19H18Cl2N2O |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 3-chloro-N-[1-(3-chlorophenyl)propan-2-yl]-6-methoxyisoquinolin-1-amine |
| SMILES | COc1ccc2c(NC(C)Cc3cccc(Cl)c3)nc(Cl)cc2c1 |
| InChI | InChI=1S/C19H18Cl2N2O/c1-12(8-13-4-3-5-15(20)9-13)22-19-17-7-6-16(24-2)10-14(17)11-18(21)23-19/h3-7,9-12H,8H2,1-2H3,(H,22,23) |
| InChIKey | STQVYNPXNUQLNQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|