C21H22ClNO2S2 — CID 166322907
N-[(4-chlorophenyl)-(4-methylphenyl)methyl]-5-propylthiophene-2-sulfonamide (PubChem CID 166322907) has the molecular formula C21H22ClNO2S2 and a molecular weight of 420.00 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-(4-methylphenyl)methyl]-5-propylthiophene-2-sulfonamide.
| Compound Name | N-[(4-chlorophenyl)-(4-methylphenyl)methyl]-5-propylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 166322907 |
| Molecular Formula | C21H22ClNO2S2 |
| Molecular Weight | 420.00 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-[(4-chlorophenyl)-(4-methylphenyl)methyl]-5-propylthiophene-2-sulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)NC(c2ccc(C)cc2)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C21H22ClNO2S2/c1-3-4-19-13-14-20(26-19)27(24,25)23-21(16-7-5-15(2)6-8-16)17-9-11-18(22)12-10-17/h5-14,21,23H,3-4H2,1-2H3 |
| InChIKey | UJMHVQZPYJAIHC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.00 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |