C19H22ClNO4 — CID 166323447
methyl 2-(2-chloro-6-oxaspiro[2.5]octane-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 166323447) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is methyl 2-(2-chloro-6-oxaspiro[2.5]octane-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | methyl 2-(2-chloro-6-oxaspiro[2.5]octane-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 166323447 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | methyl 2-(2-chloro-6-oxaspiro[2.5]octane-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | COC(=O)C1Cc2ccccc2CN1C(=O)C1(Cl)CC12CCOCC2 |
| InChI | InChI=1S/C19H22ClNO4/c1-24-16(22)15-10-13-4-2-3-5-14(13)11-21(15)17(23)19(20)12-18(19)6-8-25-9-7-18/h2-5,15H,6-12H2,1H3 |
| InChIKey | KMCFFPPTXLZIKC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|