C14H14N4 — CID 166323588
N-(1H-pyrazol-4-ylmethyl)-1-quinolin-7-ylmethanamine (PubChem CID 166323588) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is N-(1H-pyrazol-4-ylmethyl)-1-quinolin-7-ylmethanamine.
| Compound Name | N-(1H-pyrazol-4-ylmethyl)-1-quinolin-7-ylmethanamine |
|---|---|
| PubChem CID | 166323588 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | N-(1H-pyrazol-4-ylmethyl)-1-quinolin-7-ylmethanamine |
| SMILES | c1cnc2cc(CNCc3cn[nH]c3)ccc2c1 |
| InChI | InChI=1S/C14H14N4/c1-2-13-4-3-11(6-14(13)16-5-1)7-15-8-12-9-17-18-10-12/h1-6,9-10,15H,7-8H2,(H,17,18) |
| InChIKey | JNJVGHPQXMTCEB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |