C11H10F3N3 — CID 63050204
N-(1H-pyrazol-4-ylmethyl)-1-(3,4,5-trifluorophenyl)methanamine (PubChem CID 63050204) has the molecular formula C11H10F3N3 and a molecular weight of 241.22 g/mol. Its IUPAC name is N-(1H-pyrazol-4-ylmethyl)-1-(3,4,5-trifluorophenyl)methanamine.
| Compound Name | N-(1H-pyrazol-4-ylmethyl)-1-(3,4,5-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 63050204 |
| Molecular Formula | C11H10F3N3 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | N-(1H-pyrazol-4-ylmethyl)-1-(3,4,5-trifluorophenyl)methanamine |
| SMILES | Fc1cc(CNCc2cn[nH]c2)cc(F)c1F |
| InChI | InChI=1S/C11H10F3N3/c12-9-1-7(2-10(13)11(9)14)3-15-4-8-5-16-17-6-8/h1-2,5-6,15H,3-4H2,(H,16,17) |
| InChIKey | GPUSWNIFQXIVFY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|