C12H12F3N3 — CID 54897524
N-(1H-pyrazol-4-ylmethyl)-1-[2-(trifluoromethyl)phenyl]methanamine (PubChem CID 54897524) has the molecular formula C12H12F3N3 and a molecular weight of 255.24 g/mol. Its IUPAC name is N-(1H-pyrazol-4-ylmethyl)-1-[2-(trifluoromethyl)phenyl]methanamine.
| Compound Name | N-(1H-pyrazol-4-ylmethyl)-1-[2-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 54897524 |
| Molecular Formula | C12H12F3N3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-(1H-pyrazol-4-ylmethyl)-1-[2-(trifluoromethyl)phenyl]methanamine |
| SMILES | FC(F)(F)c1ccccc1CNCc1cn[nH]c1 |
| InChI | InChI=1S/C12H12F3N3/c13-12(14,15)11-4-2-1-3-10(11)8-16-5-9-6-17-18-7-9/h1-4,6-7,16H,5,8H2,(H,17,18) |
| InChIKey | LYEZTRZXBWYIRP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |