C11H10F3N3O2S — CID 62050076
N-[[2-(trifluoromethyl)phenyl]methyl]-1H-pyrazole-4-sulfonamide (PubChem CID 62050076) has the molecular formula C11H10F3N3O2S and a molecular weight of 305.28 g/mol. Its IUPAC name is N-[[2-(trifluoromethyl)phenyl]methyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[[2-(trifluoromethyl)phenyl]methyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 62050076 |
| Molecular Formula | C11H10F3N3O2S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | N-[[2-(trifluoromethyl)phenyl]methyl]-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1C(F)(F)F)c1cn[nH]c1 |
| InChI | InChI=1S/C11H10F3N3O2S/c12-11(13,14)10-4-2-1-3-8(10)5-17-20(18,19)9-6-15-16-7-9/h1-4,6-7,17H,5H2,(H,15,16) |
| InChIKey | CUCSXYSDOGZIOJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |