C10H9F2N3O2S — CID 62050435
N-[(2,4-difluorophenyl)methyl]-1H-pyrazole-4-sulfonamide (PubChem CID 62050435) has the molecular formula C10H9F2N3O2S and a molecular weight of 273.26 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 62050435 |
| Molecular Formula | C10H9F2N3O2S |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NCc1ccc(F)cc1F)c1cn[nH]c1 |
| InChI | InChI=1S/C10H9F2N3O2S/c11-8-2-1-7(10(12)3-8)4-15-18(16,17)9-5-13-14-6-9/h1-3,5-6,15H,4H2,(H,13,14) |
| InChIKey | YUPKOKDANNUDTA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |