C11H12ClN3O2S — CID 65032352
N-[[3-(chloromethyl)phenyl]methyl]-1H-pyrazole-4-sulfonamide (PubChem CID 65032352) has the molecular formula C11H12ClN3O2S and a molecular weight of 285.76 g/mol. Its IUPAC name is N-[[3-(chloromethyl)phenyl]methyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[[3-(chloromethyl)phenyl]methyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 65032352 |
| Molecular Formula | C11H12ClN3O2S |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | N-[[3-(chloromethyl)phenyl]methyl]-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NCc1cccc(CCl)c1)c1cn[nH]c1 |
| InChI | InChI=1S/C11H12ClN3O2S/c12-5-9-2-1-3-10(4-9)6-15-18(16,17)11-7-13-14-8-11/h1-4,7-8,15H,5-6H2,(H,13,14) |
| InChIKey | SPKQAGVCLWYCJD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|