C14H12ClF2NO3S — CID 110782247
3-chloro-N-[(2,4-difluorophenyl)methyl]-4-methoxybenzenesulfonamide (PubChem CID 110782247) has the molecular formula C14H12ClF2NO3S and a molecular weight of 347.77 g/mol. Its IUPAC name is 3-chloro-N-[(2,4-difluorophenyl)methyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-[(2,4-difluorophenyl)methyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110782247 |
| Molecular Formula | C14H12ClF2NO3S |
| Molecular Weight | 347.77 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 3-chloro-N-[(2,4-difluorophenyl)methyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2ccc(F)cc2F)cc1Cl |
| InChI | InChI=1S/C14H12ClF2NO3S/c1-21-14-5-4-11(7-12(14)15)22(19,20)18-8-9-2-3-10(16)6-13(9)17/h2-7,18H,8H2,1H3 |
| InChIKey | AOWPLYDFCYRJSL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.77 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |