C14H13ClFNO3S — CID 110780300
N-[(5-chloro-2-methoxyphenyl)methyl]-4-fluorobenzenesulfonamide (PubChem CID 110780300) has the molecular formula C14H13ClFNO3S and a molecular weight of 329.78 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 110780300 |
| Molecular Formula | C14H13ClFNO3S |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-4-fluorobenzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1CNS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H13ClFNO3S/c1-20-14-7-2-11(15)8-10(14)9-17-21(18,19)13-5-3-12(16)4-6-13/h2-8,17H,9H2,1H3 |
| InChIKey | NCZPGFCSVVHCRB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |