C19H15N5O2 — CID 166326947
N-[(1-oxo-2H-isoquinolin-4-yl)methyl]-3-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 166326947) has the molecular formula C19H15N5O2 and a molecular weight of 345.36 g/mol. Its IUPAC name is N-[(1-oxo-2H-isoquinolin-4-yl)methyl]-3-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | N-[(1-oxo-2H-isoquinolin-4-yl)methyl]-3-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 166326947 |
| Molecular Formula | C19H15N5O2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-[(1-oxo-2H-isoquinolin-4-yl)methyl]-3-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | O=C(NCc1c[nH]c(=O)c2ccccc12)c1cccc(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C19H15N5O2/c25-18(13-5-3-4-12(8-13)17-22-11-23-24-17)20-9-14-10-21-19(26)16-7-2-1-6-15(14)16/h1-8,10-11H,9H2,(H,20,25)(H,21,26)(H,22,23,24) |
| InChIKey | MVTPTSJVSQPEQP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |