C17H16N4O2 — CID 110001278
N-(2-hydroxy-1-phenylethyl)-3-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 110001278) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is N-(2-hydroxy-1-phenylethyl)-3-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | N-(2-hydroxy-1-phenylethyl)-3-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 110001278 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-(2-hydroxy-1-phenylethyl)-3-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | O=C(NC(CO)c1ccccc1)c1cccc(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C17H16N4O2/c22-10-15(12-5-2-1-3-6-12)20-17(23)14-8-4-7-13(9-14)16-18-11-19-21-16/h1-9,11,15,22H,10H2,(H,20,23)(H,18,19,21) |
| InChIKey | GFDWDUKSQDJLAF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |