C21H17FN6O2 — CID 166327293
1-(4-fluorophenyl)-N-[6-(4-methoxyphenyl)pyrimidin-4-yl]-5-methyltriazole-4-carboxamide (PubChem CID 166327293) has the molecular formula C21H17FN6O2 and a molecular weight of 404.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[6-(4-methoxyphenyl)pyrimidin-4-yl]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[6-(4-methoxyphenyl)pyrimidin-4-yl]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 166327293 |
| Molecular Formula | C21H17FN6O2 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[6-(4-methoxyphenyl)pyrimidin-4-yl]-5-methyltriazole-4-carboxamide |
| SMILES | COc1ccc(-c2cc(NC(=O)c3nnn(-c4ccc(F)cc4)c3C)ncn2)cc1 |
| InChI | InChI=1S/C21H17FN6O2/c1-13-20(26-27-28(13)16-7-5-15(22)6-8-16)21(29)25-19-11-18(23-12-24-19)14-3-9-17(30-2)10-4-14/h3-12H,1-2H3,(H,23,24,25,29) |
| InChIKey | QPEQRUOIIBNMNG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |