C19H21N5O2S2 — CID 166328844
5-(5,6-dimethyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-yl)-2,3,3a,4,6,7-hexahydro-[1,2]thiazolo[2,3-a]pyrazine 1,1-dioxide (PubChem CID 166328844) has the molecular formula C19H21N5O2S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 5-(5,6-dimethyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-yl)-2,3,3a,4,6,7-hexahydro-[1,2]thiazolo[2,3-a]pyrazine 1,1-dioxide.
| Compound Name | 5-(5,6-dimethyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-yl)-2,3,3a,4,6,7-hexahydro-[1,2]thiazolo[2,3-a]pyrazine 1,1-dioxide |
|---|---|
| PubChem CID | 166328844 |
| Molecular Formula | C19H21N5O2S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 5-(5,6-dimethyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-yl)-2,3,3a,4,6,7-hexahydro-[1,2]thiazolo[2,3-a]pyrazine 1,1-dioxide |
| SMILES | Cc1sc2nc(-c3cccnc3)nc(N3CCN4C(CCS4(=O)=O)C3)c2c1C |
| InChI | InChI=1S/C19H21N5O2S2/c1-12-13(2)27-19-16(12)18(21-17(22-19)14-4-3-6-20-10-14)23-7-8-24-15(11-23)5-9-28(24,25)26/h3-4,6,10,15H,5,7-9,11H2,1-2H3 |
| InChIKey | RKVLSLOPWAGFBG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |