C24H29N5O4 — CID 166329109
1-[2-[3-[1-(1H-indazole-4-carbonyl)piperidin-4-yl]piperidin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione (PubChem CID 166329109) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is 1-[2-[3-[1-(1H-indazole-4-carbonyl)piperidin-4-yl]piperidin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[3-[1-(1H-indazole-4-carbonyl)piperidin-4-yl]piperidin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 166329109 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 1-[2-[3-[1-(1H-indazole-4-carbonyl)piperidin-4-yl]piperidin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
| SMILES | O=C(CN1C(=O)CCC1=O)N1CCCC(C2CCN(C(=O)c3cccc4[nH]ncc34)CC2)C1 |
| InChI | InChI=1S/C24H29N5O4/c30-21-6-7-22(31)29(21)15-23(32)28-10-2-3-17(14-28)16-8-11-27(12-9-16)24(33)18-4-1-5-20-19(18)13-25-26-20/h1,4-5,13,16-17H,2-3,6-12,14-15H2,(H,25,26) |
| InChIKey | CWDVLBNDXUIXMI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|