C14H17N5O3 — CID 166329274
2-[2-[(4-methoxy-1H-pyrazol-5-yl)carbamoylamino]phenyl]-N-methylacetamide (PubChem CID 166329274) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-[2-[(4-methoxy-1H-pyrazol-5-yl)carbamoylamino]phenyl]-N-methylacetamide.
| Compound Name | 2-[2-[(4-methoxy-1H-pyrazol-5-yl)carbamoylamino]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 166329274 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-[2-[(4-methoxy-1H-pyrazol-5-yl)carbamoylamino]phenyl]-N-methylacetamide |
| SMILES | CNC(=O)Cc1ccccc1NC(=O)Nc1[nH]ncc1OC |
| InChI | InChI=1S/C14H17N5O3/c1-15-12(20)7-9-5-3-4-6-10(9)17-14(21)18-13-11(22-2)8-16-19-13/h3-6,8H,7H2,1-2H3,(H,15,20)(H3,16,17,18,19,21) |
| InChIKey | IHPYEOSJARUXOP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |