C18H19NO4S — CID 166331965
4-[[methyl-(2-phenylcyclopropyl)sulfonylamino]methyl]benzoic acid (PubChem CID 166331965) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is 4-[[methyl-(2-phenylcyclopropyl)sulfonylamino]methyl]benzoic acid.
| Compound Name | 4-[[methyl-(2-phenylcyclopropyl)sulfonylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 166331965 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 4-[[methyl-(2-phenylcyclopropyl)sulfonylamino]methyl]benzoic acid |
| SMILES | CN(Cc1ccc(C(=O)O)cc1)S(=O)(=O)C1CC1c1ccccc1 |
| InChI | InChI=1S/C18H19NO4S/c1-19(12-13-7-9-15(10-8-13)18(20)21)24(22,23)17-11-16(17)14-5-3-2-4-6-14/h2-10,16-17H,11-12H2,1H3,(H,20,21) |
| InChIKey | HPGXXCXZDRCXGX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |