C14H19ClFNO4S — CID 166332057
N-[1-(4-chloro-2-fluorophenyl)-2-methylpropyl]-4-hydroxyoxolane-3-sulfonamide (PubChem CID 166332057) has the molecular formula C14H19ClFNO4S and a molecular weight of 351.83 g/mol. Its IUPAC name is N-[1-(4-chloro-2-fluorophenyl)-2-methylpropyl]-4-hydroxyoxolane-3-sulfonamide.
| Compound Name | N-[1-(4-chloro-2-fluorophenyl)-2-methylpropyl]-4-hydroxyoxolane-3-sulfonamide |
|---|---|
| PubChem CID | 166332057 |
| Molecular Formula | C14H19ClFNO4S |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N-[1-(4-chloro-2-fluorophenyl)-2-methylpropyl]-4-hydroxyoxolane-3-sulfonamide |
| SMILES | CC(C)C(NS(=O)(=O)C1COCC1O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C14H19ClFNO4S/c1-8(2)14(10-4-3-9(15)5-11(10)16)17-22(19,20)13-7-21-6-12(13)18/h3-5,8,12-14,17-18H,6-7H2,1-2H3 |
| InChIKey | BGXAFFMZDZVTCX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |