C15H21ClFNO3S — CID 75519267
N-[1-(4-chloro-2-fluorophenyl)-2-methylpropyl]-1-(oxolan-3-yl)methanesulfonamide (PubChem CID 75519267) has the molecular formula C15H21ClFNO3S and a molecular weight of 349.86 g/mol. Its IUPAC name is N-[1-(4-chloro-2-fluorophenyl)-2-methylpropyl]-1-(oxolan-3-yl)methanesulfonamide.
| Compound Name | N-[1-(4-chloro-2-fluorophenyl)-2-methylpropyl]-1-(oxolan-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 75519267 |
| Molecular Formula | C15H21ClFNO3S |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-[1-(4-chloro-2-fluorophenyl)-2-methylpropyl]-1-(oxolan-3-yl)methanesulfonamide |
| SMILES | CC(C)C(NS(=O)(=O)CC1CCOC1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H21ClFNO3S/c1-10(2)15(13-4-3-12(16)7-14(13)17)18-22(19,20)9-11-5-6-21-8-11/h3-4,7,10-11,15,18H,5-6,8-9H2,1-2H3 |
| InChIKey | JQLUPEQLTSZMSR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |