C29H34N4O2 — CID 166332793
N-(4-tert-butylphenyl)-N-[2-(cyclohexylamino)-2-oxo-1-pyrazin-2-ylethyl]benzamide (PubChem CID 166332793) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N-[2-(cyclohexylamino)-2-oxo-1-pyrazin-2-ylethyl]benzamide.
| Compound Name | N-(4-tert-butylphenyl)-N-[2-(cyclohexylamino)-2-oxo-1-pyrazin-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 166332793 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | N-(4-tert-butylphenyl)-N-[2-(cyclohexylamino)-2-oxo-1-pyrazin-2-ylethyl]benzamide |
| SMILES | CC(C)(C)c1ccc(N(C(=O)c2ccccc2)C(C(=O)NC2CCCCC2)c2cnccn2)cc1 |
| InChI | InChI=1S/C29H34N4O2/c1-29(2,3)22-14-16-24(17-15-22)33(28(35)21-10-6-4-7-11-21)26(25-20-30-18-19-31-25)27(34)32-23-12-8-5-9-13-23/h4,6-7,10-11,14-20,23,26H,5,8-9,12-13H2,1-3H3,(H,32,34) |
| InChIKey | PPGMGEGQHWLCAG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |