C14H14N4O5 — CID 166337204
4-[(3aR,6aS)-5-(1,3-oxazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]-3H-1,3-oxazol-2-one (PubChem CID 166337204) has the molecular formula C14H14N4O5 and a molecular weight of 318.29 g/mol. Its IUPAC name is 4-[(3aR,6aS)-5-(1,3-oxazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]-3H-1,3-oxazol-2-one.
| Compound Name | 4-[(3aR,6aS)-5-(1,3-oxazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]-3H-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 166337204 |
| Molecular Formula | C14H14N4O5 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 4-[(3aR,6aS)-5-(1,3-oxazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]-3H-1,3-oxazol-2-one |
| SMILES | O=C(c1cocn1)N1C[C@@H]2CN(C(=O)c3coc(=O)[nH]3)C[C@@H]2C1 |
| InChI | InChI=1S/C14H14N4O5/c19-12(10-5-22-7-15-10)17-1-8-3-18(4-9(8)2-17)13(20)11-6-23-14(21)16-11/h5-9H,1-4H2,(H,16,21)/t8-,9+ |
| InChIKey | HDWIDABEKOGBJE-DTORHVGOSA-N |
| XLogP | -0.20 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |