C24H19ClN6O3 — CID 166338326
N-(5-chloro-2-pyridinyl)-3-[[2-oxo-2-(quinolin-3-ylamino)ethyl]carbamoylamino]benzamide (PubChem CID 166338326) has the molecular formula C24H19ClN6O3 and a molecular weight of 474.91 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-3-[[2-oxo-2-(quinolin-3-ylamino)ethyl]carbamoylamino]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-3-[[2-oxo-2-(quinolin-3-ylamino)ethyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 166338326 |
| Molecular Formula | C24H19ClN6O3 |
| Molecular Weight | 474.91 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-3-[[2-oxo-2-(quinolin-3-ylamino)ethyl]carbamoylamino]benzamide |
| SMILES | O=C(CNC(=O)Nc1cccc(C(=O)Nc2ccc(Cl)cn2)c1)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C24H19ClN6O3/c25-17-8-9-21(27-12-17)31-23(33)16-5-3-6-18(11-16)30-24(34)28-14-22(32)29-19-10-15-4-1-2-7-20(15)26-13-19/h1-13H,14H2,(H,29,32)(H,27,31,33)(H2,28,30,34) |
| InChIKey | CXVFLONBGQUXNH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 125.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.91 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |