C20H15Cl2N3O2S — CID 18913238
3-chloro-N-[3-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylphenyl]benzamide (PubChem CID 18913238) has the molecular formula C20H15Cl2N3O2S and a molecular weight of 432.33 g/mol. Its IUPAC name is 3-chloro-N-[3-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylphenyl]benzamide.
| Compound Name | 3-chloro-N-[3-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18913238 |
| Molecular Formula | C20H15Cl2N3O2S |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 3-chloro-N-[3-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylphenyl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)c2cccc(Cl)c2)c1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C20H15Cl2N3O2S/c21-14-4-1-3-13(9-14)20(27)24-16-5-2-6-17(10-16)28-12-19(26)25-18-8-7-15(22)11-23-18/h1-11H,12H2,(H,24,27)(H,23,25,26) |
| InChIKey | WNRYCTNVAVLSNE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |