C23H28N2O — CID 166338651
1-[[1-(4-phenoxyphenyl)butylamino]methyl]cyclopentane-1-carbonitrile (PubChem CID 166338651) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-[[1-(4-phenoxyphenyl)butylamino]methyl]cyclopentane-1-carbonitrile.
| Compound Name | 1-[[1-(4-phenoxyphenyl)butylamino]methyl]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 166338651 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 1-[[1-(4-phenoxyphenyl)butylamino]methyl]cyclopentane-1-carbonitrile |
| SMILES | CCCC(NCC1(C#N)CCCC1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H28N2O/c1-2-8-22(25-18-23(17-24)15-6-7-16-23)19-11-13-21(14-12-19)26-20-9-4-3-5-10-20/h3-5,9-14,22,25H,2,6-8,15-16,18H2,1H3 |
| InChIKey | BJUUERKALVNVTG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |