C20H26N2O2 — CID 166338701
3-[[1-(4-phenoxyphenyl)butylamino]methyl]azetidin-3-ol (PubChem CID 166338701) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-[[1-(4-phenoxyphenyl)butylamino]methyl]azetidin-3-ol.
| Compound Name | 3-[[1-(4-phenoxyphenyl)butylamino]methyl]azetidin-3-ol |
|---|---|
| PubChem CID | 166338701 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 3-[[1-(4-phenoxyphenyl)butylamino]methyl]azetidin-3-ol |
| SMILES | CCCC(NCC1(O)CNC1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N2O2/c1-2-6-19(22-15-20(23)13-21-14-20)16-9-11-18(12-10-16)24-17-7-4-3-5-8-17/h3-5,7-12,19,21-23H,2,6,13-15H2,1H3 |
| InChIKey | WRPRBQJBJHEPCR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |