C22H27N3O — CID 166338702
1,3,5-trimethyl-N-[1-(4-phenoxyphenyl)butyl]pyrazol-4-amine (PubChem CID 166338702) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-[1-(4-phenoxyphenyl)butyl]pyrazol-4-amine.
| Compound Name | 1,3,5-trimethyl-N-[1-(4-phenoxyphenyl)butyl]pyrazol-4-amine |
|---|---|
| PubChem CID | 166338702 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 1,3,5-trimethyl-N-[1-(4-phenoxyphenyl)butyl]pyrazol-4-amine |
| SMILES | CCCC(Nc1c(C)nn(C)c1C)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H27N3O/c1-5-9-21(23-22-16(2)24-25(4)17(22)3)18-12-14-20(15-13-18)26-19-10-7-6-8-11-19/h6-8,10-15,21,23H,5,9H2,1-4H3 |
| InChIKey | YGUDVCILRDMMEO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |