C11H21N3 — CID 43204532
1,3,5-trimethyl-N-pentan-2-ylpyrazol-4-amine (PubChem CID 43204532) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-pentan-2-ylpyrazol-4-amine.
| Compound Name | 1,3,5-trimethyl-N-pentan-2-ylpyrazol-4-amine |
|---|---|
| PubChem CID | 43204532 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1,3,5-trimethyl-N-pentan-2-ylpyrazol-4-amine |
| SMILES | CCCC(C)Nc1c(C)nn(C)c1C |
| InChI | InChI=1S/C11H21N3/c1-6-7-8(2)12-11-9(3)13-14(5)10(11)4/h8,12H,6-7H2,1-5H3 |
| InChIKey | STUQSMCZONJFEE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |