About 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid
3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid (PubChem CID 82539337) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid.
Analyze 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid?
The IUPAC name of 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid (CID 82539337) is 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid.
What is the SMILES notation for 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid?
The canonical SMILES for 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid is Cc1nn(C)c(C)c1NC(C(=O)O)C(C)C.
What is the InChIKey of 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid?
The InChIKey is IPBYWABSXGXXEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2/c1-6(2)9(11(15)16)12-10-7(3)13-14(5)8(10)4/h6,9,12H,1-5H3,(H,15,16).
What are the key properties of 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid?
3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid has a molecular weight of 225.29 g/mol, XLogP of 1.56, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid is sourced from PubChem (CID 82539337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).