3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid

C11H19N3O2 — CID 82539337

IUPAC3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid
SMILESCc1nn(C)c(C)c1NC(C(=O)O)C(C)C
InChIInChI=1S/C11H19N3O2/c1-6(2)9(11(15)16)12-10-7(3)13-14(5)8(10)4/h6,9,12H,1-5H3,(H,15,16)
InChIKeyIPBYWABSXGXXEE-UHFFFAOYSA-N
MW225.29 g/mol
LogP1.56
Rot. Bonds4

About 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid

3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid (PubChem CID 82539337) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid.

Molecular Properties

Compound Name3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid
PubChem CID82539337
Molecular FormulaC11H19N3O2
Molecular Weight225.29 g/mol
Exact Mass225.15
IUPAC Name3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid
SMILESCc1nn(C)c(C)c1NC(C(=O)O)C(C)C
InChIInChI=1S/C11H19N3O2/c1-6(2)9(11(15)16)12-10-7(3)13-14(5)8(10)4/h6,9,12H,1-5H3,(H,15,16)
InChIKeyIPBYWABSXGXXEE-UHFFFAOYSA-N
XLogP1.56
TPSA67.15 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.29
LogP ≤ 51.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid?
The IUPAC name of 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid (CID 82539337) is 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid.
What is the SMILES notation for 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid?
The canonical SMILES for 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid is Cc1nn(C)c(C)c1NC(C(=O)O)C(C)C.
What is the InChIKey of 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid?
The InChIKey is IPBYWABSXGXXEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2/c1-6(2)9(11(15)16)12-10-7(3)13-14(5)8(10)4/h6,9,12H,1-5H3,(H,15,16).
What are the key properties of 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid?
3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid has a molecular weight of 225.29 g/mol, XLogP of 1.56, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-[(1,3,5-trimethylpyrazol-4-yl)amino]butanoic acid is sourced from PubChem (CID 82539337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).