(2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid

C9H14N2O2S — CID 129451870

IUPAC(2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid
SMILESCc1nn(C)c(C)c1S[C@@H](C)C(=O)O
InChIInChI=1S/C9H14N2O2S/c1-5-8(6(2)11(4)10-5)14-7(3)9(12)13/h7H,1-4H3,(H,12,13)/t7-/m0/s1
InChIKeyPUXLPNQZQPGWNH-ZETCQYMHSA-N
MW214.29 g/mol
LogP1.60
Rot. Bonds3

About (2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid

(2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid (PubChem CID 129451870) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is (2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid.

Molecular Properties

Compound Name(2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid
PubChem CID129451870
Molecular FormulaC9H14N2O2S
Molecular Weight214.29 g/mol
Exact Mass214.08
IUPAC Name(2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid
SMILESCc1nn(C)c(C)c1S[C@@H](C)C(=O)O
InChIInChI=1S/C9H14N2O2S/c1-5-8(6(2)11(4)10-5)14-7(3)9(12)13/h7H,1-4H3,(H,12,13)/t7-/m0/s1
InChIKeyPUXLPNQZQPGWNH-ZETCQYMHSA-N
XLogP1.60
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.29
LogP ≤ 51.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid?
The IUPAC name of (2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid (CID 129451870) is (2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid.
What is the SMILES notation for (2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid?
The canonical SMILES for (2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid is Cc1nn(C)c(C)c1S[C@@H](C)C(=O)O.
What is the InChIKey of (2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid?
The InChIKey is PUXLPNQZQPGWNH-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-5-8(6(2)11(4)10-5)14-7(3)9(12)13/h7H,1-4H3,(H,12,13)/t7-/m0/s1.
What are the key properties of (2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid?
(2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid has a molecular weight of 214.29 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(1,3,5-trimethylpyrazol-4-yl)sulfanylpropanoic acid is sourced from PubChem (CID 129451870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).