C10H20N4 — CID 130573982
3-N-(1,3,5-trimethylpyrazol-4-yl)butane-2,3-diamine (PubChem CID 130573982) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 3-N-(1,3,5-trimethylpyrazol-4-yl)butane-2,3-diamine.
| Compound Name | 3-N-(1,3,5-trimethylpyrazol-4-yl)butane-2,3-diamine |
|---|---|
| PubChem CID | 130573982 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 3-N-(1,3,5-trimethylpyrazol-4-yl)butane-2,3-diamine |
| SMILES | Cc1nn(C)c(C)c1NC(C)C(C)N |
| InChI | InChI=1S/C10H20N4/c1-6(11)7(2)12-10-8(3)13-14(5)9(10)4/h6-7,12H,11H2,1-5H3 |
| InChIKey | XNUBYUYOUQQXNG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |