C21H25ClN2O5 — CID 166338901
tert-butyl N-[2-[4-(4-chlorophenoxy)piperidine-1-carbonyl]furan-3-yl]carbamate (PubChem CID 166338901) has the molecular formula C21H25ClN2O5 and a molecular weight of 420.89 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(4-chlorophenoxy)piperidine-1-carbonyl]furan-3-yl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(4-chlorophenoxy)piperidine-1-carbonyl]furan-3-yl]carbamate |
|---|---|
| PubChem CID | 166338901 |
| Molecular Formula | C21H25ClN2O5 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | tert-butyl N-[2-[4-(4-chlorophenoxy)piperidine-1-carbonyl]furan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccoc1C(=O)N1CCC(Oc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H25ClN2O5/c1-21(2,3)29-20(26)23-17-10-13-27-18(17)19(25)24-11-8-16(9-12-24)28-15-6-4-14(22)5-7-15/h4-7,10,13,16H,8-9,11-12H2,1-3H3,(H,23,26) |
| InChIKey | QUXQIVMJDAWKLU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |