C21H18Cl2N2O2S — CID 166338912
[4-(4-chlorophenoxy)piperidin-1-yl]-[5-(5-chlorothiophen-2-yl)-2-pyridinyl]methanone (PubChem CID 166338912) has the molecular formula C21H18Cl2N2O2S and a molecular weight of 433.36 g/mol. Its IUPAC name is [4-(4-chlorophenoxy)piperidin-1-yl]-[5-(5-chlorothiophen-2-yl)-2-pyridinyl]methanone.
| Compound Name | [4-(4-chlorophenoxy)piperidin-1-yl]-[5-(5-chlorothiophen-2-yl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 166338912 |
| Molecular Formula | C21H18Cl2N2O2S |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | [4-(4-chlorophenoxy)piperidin-1-yl]-[5-(5-chlorothiophen-2-yl)-2-pyridinyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc(Cl)s2)cn1)N1CCC(Oc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H18Cl2N2O2S/c22-15-2-4-16(5-3-15)27-17-9-11-25(12-10-17)21(26)18-6-1-14(13-24-18)19-7-8-20(23)28-19/h1-8,13,17H,9-12H2 |
| InChIKey | XUOQVKFHAHYAMC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |