C20H22ClFN2O3 — CID 166338931
[4-(4-chlorophenoxy)piperidin-1-yl]-(3-fluoro-2-propan-2-yloxy-4-pyridinyl)methanone (PubChem CID 166338931) has the molecular formula C20H22ClFN2O3 and a molecular weight of 392.86 g/mol. Its IUPAC name is [4-(4-chlorophenoxy)piperidin-1-yl]-(3-fluoro-2-propan-2-yloxy-4-pyridinyl)methanone.
| Compound Name | [4-(4-chlorophenoxy)piperidin-1-yl]-(3-fluoro-2-propan-2-yloxy-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 166338931 |
| Molecular Formula | C20H22ClFN2O3 |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [4-(4-chlorophenoxy)piperidin-1-yl]-(3-fluoro-2-propan-2-yloxy-4-pyridinyl)methanone |
| SMILES | CC(C)Oc1nccc(C(=O)N2CCC(Oc3ccc(Cl)cc3)CC2)c1F |
| InChI | InChI=1S/C20H22ClFN2O3/c1-13(2)26-19-18(22)17(7-10-23-19)20(25)24-11-8-16(9-12-24)27-15-5-3-14(21)4-6-15/h3-7,10,13,16H,8-9,11-12H2,1-2H3 |
| InChIKey | JNESEWCHKPYSJF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |