C14H17FN4O3S — CID 166339212
4-(4-ethoxy-3-fluorophenyl)-1-(1-methylsulfonylazetidin-3-yl)triazole (PubChem CID 166339212) has the molecular formula C14H17FN4O3S and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-(4-ethoxy-3-fluorophenyl)-1-(1-methylsulfonylazetidin-3-yl)triazole.
| Compound Name | 4-(4-ethoxy-3-fluorophenyl)-1-(1-methylsulfonylazetidin-3-yl)triazole |
|---|---|
| PubChem CID | 166339212 |
| Molecular Formula | C14H17FN4O3S |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 4-(4-ethoxy-3-fluorophenyl)-1-(1-methylsulfonylazetidin-3-yl)triazole |
| SMILES | CCOc1ccc(-c2cn(C3CN(S(C)(=O)=O)C3)nn2)cc1F |
| InChI | InChI=1S/C14H17FN4O3S/c1-3-22-14-5-4-10(6-12(14)15)13-9-19(17-16-13)11-7-18(8-11)23(2,20)21/h4-6,9,11H,3,7-8H2,1-2H3 |
| InChIKey | ISSPJTCDJISOOF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |