C16H12Cl2N4O2S — CID 166339650
N-[2-[4-(3-chlorophenyl)triazol-1-yl]ethyl]-2-(5-chlorothiophen-2-yl)-2-oxoacetamide (PubChem CID 166339650) has the molecular formula C16H12Cl2N4O2S and a molecular weight of 395.27 g/mol. Its IUPAC name is N-[2-[4-(3-chlorophenyl)triazol-1-yl]ethyl]-2-(5-chlorothiophen-2-yl)-2-oxoacetamide.
| Compound Name | N-[2-[4-(3-chlorophenyl)triazol-1-yl]ethyl]-2-(5-chlorothiophen-2-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 166339650 |
| Molecular Formula | C16H12Cl2N4O2S |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | N-[2-[4-(3-chlorophenyl)triazol-1-yl]ethyl]-2-(5-chlorothiophen-2-yl)-2-oxoacetamide |
| SMILES | O=C(NCCn1cc(-c2cccc(Cl)c2)nn1)C(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H12Cl2N4O2S/c17-11-3-1-2-10(8-11)12-9-22(21-20-12)7-6-19-16(24)15(23)13-4-5-14(18)25-13/h1-5,8-9H,6-7H2,(H,19,24) |
| InChIKey | YVQHBZZDOYMQQQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|