C18H20N4 — CID 72915566
N-methyl-2-[4-[3-(2-methylphenyl)phenyl]triazol-1-yl]ethanamine (PubChem CID 72915566) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is N-methyl-2-[4-[3-(2-methylphenyl)phenyl]triazol-1-yl]ethanamine.
| Compound Name | N-methyl-2-[4-[3-(2-methylphenyl)phenyl]triazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 72915566 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | N-methyl-2-[4-[3-(2-methylphenyl)phenyl]triazol-1-yl]ethanamine |
| SMILES | CNCCn1cc(-c2cccc(-c3ccccc3C)c2)nn1 |
| InChI | InChI=1S/C18H20N4/c1-14-6-3-4-9-17(14)15-7-5-8-16(12-15)18-13-22(21-20-18)11-10-19-2/h3-9,12-13,19H,10-11H2,1-2H3 |
| InChIKey | USDZJOCNRCIWHV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |