C17H16N4O — CID 166339816
2-pyrazol-1-yl-N-[(2-pyridin-3-ylphenyl)methyl]acetamide (PubChem CID 166339816) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-pyrazol-1-yl-N-[(2-pyridin-3-ylphenyl)methyl]acetamide.
| Compound Name | 2-pyrazol-1-yl-N-[(2-pyridin-3-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 166339816 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-pyrazol-1-yl-N-[(2-pyridin-3-ylphenyl)methyl]acetamide |
| SMILES | O=C(Cn1cccn1)NCc1ccccc1-c1cccnc1 |
| InChI | InChI=1S/C17H16N4O/c22-17(13-21-10-4-9-20-21)19-12-15-5-1-2-7-16(15)14-6-3-8-18-11-14/h1-11H,12-13H2,(H,19,22) |
| InChIKey | IAOUEANGNQESMC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |