C17H23ClN4 — CID 166340795
4-N-[3-(3-chlorophenyl)propyl]-2-N,2-N-diethylpyrimidine-2,4-diamine (PubChem CID 166340795) has the molecular formula C17H23ClN4 and a molecular weight of 318.85 g/mol. Its IUPAC name is 4-N-[3-(3-chlorophenyl)propyl]-2-N,2-N-diethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(3-chlorophenyl)propyl]-2-N,2-N-diethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166340795 |
| Molecular Formula | C17H23ClN4 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-N-[3-(3-chlorophenyl)propyl]-2-N,2-N-diethylpyrimidine-2,4-diamine |
| SMILES | CCN(CC)c1nccc(NCCCc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C17H23ClN4/c1-3-22(4-2)17-20-12-10-16(21-17)19-11-6-8-14-7-5-9-15(18)13-14/h5,7,9-10,12-13H,3-4,6,8,11H2,1-2H3,(H,19,20,21) |
| InChIKey | FZRXHWGIVYNPTR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|