C17H22ClN5 — CID 112888142
N-[2-(3-chlorophenyl)ethyl]-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112888142) has the molecular formula C17H22ClN5 and a molecular weight of 331.85 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112888142 |
| Molecular Formula | C17H22ClN5 |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | CN1CCN(c2nccc(NCCc3cccc(Cl)c3)n2)CC1 |
| InChI | InChI=1S/C17H22ClN5/c1-22-9-11-23(12-10-22)17-20-8-6-16(21-17)19-7-5-14-3-2-4-15(18)13-14/h2-4,6,8,13H,5,7,9-12H2,1H3,(H,19,20,21) |
| InChIKey | HRKQUIPFCNOGKR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |