C19H25ClN4 — CID 112900935
N-[2-(3-chlorophenyl)ethyl]-2-(2-ethylpiperidin-1-yl)pyrimidin-4-amine (PubChem CID 112900935) has the molecular formula C19H25ClN4 and a molecular weight of 344.89 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-2-(2-ethylpiperidin-1-yl)pyrimidin-4-amine.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-2-(2-ethylpiperidin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112900935 |
| Molecular Formula | C19H25ClN4 |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-2-(2-ethylpiperidin-1-yl)pyrimidin-4-amine |
| SMILES | CCC1CCCCN1c1nccc(NCCc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H25ClN4/c1-2-17-8-3-4-13-24(17)19-22-12-10-18(23-19)21-11-9-15-6-5-7-16(20)14-15/h5-7,10,12,14,17H,2-4,8-9,11,13H2,1H3,(H,21,22,23) |
| InChIKey | QNKFHSWYRSTTHI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |