C15H14FN3O7S3 — CID 166343193
(2S)-N-(3-fluoro-5-nitrophenyl)sulfonyl-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 166343193) has the molecular formula C15H14FN3O7S3 and a molecular weight of 463.49 g/mol. Its IUPAC name is (2S)-N-(3-fluoro-5-nitrophenyl)sulfonyl-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(3-fluoro-5-nitrophenyl)sulfonyl-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166343193 |
| Molecular Formula | C15H14FN3O7S3 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | (2S)-N-(3-fluoro-5-nitrophenyl)sulfonyl-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1cc(F)cc([N+](=O)[O-])c1)[C@@H]1CCCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H14FN3O7S3/c16-10-7-11(19(21)22)9-12(8-10)28(23,24)17-15(20)13-3-1-5-18(13)29(25,26)14-4-2-6-27-14/h2,4,6-9,13H,1,3,5H2,(H,17,20)/t13-/m0/s1 |
| InChIKey | VXDFSGZLDALJBA-ZDUSSCGKSA-N |
| XLogP | 1.45 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|