C19H15ClFN3O2 — CID 166343753
1-(4-chloro-2-fluorophenyl)-N-(2-hydroxyphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide (PubChem CID 166343753) has the molecular formula C19H15ClFN3O2 and a molecular weight of 371.80 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-N-(2-hydroxyphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-N-(2-hydroxyphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 166343753 |
| Molecular Formula | C19H15ClFN3O2 |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-N-(2-hydroxyphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1O)c1nn(-c2ccc(Cl)cc2F)c2c1CCC2 |
| InChI | InChI=1S/C19H15ClFN3O2/c20-11-8-9-16(13(21)10-11)24-15-6-3-4-12(15)18(23-24)19(26)22-14-5-1-2-7-17(14)25/h1-2,5,7-10,25H,3-4,6H2,(H,22,26) |
| InChIKey | UUUMTJQDACIWIG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|