C20H17FIN3O — CID 55688233
1-(2-fluorophenyl)-N-(4-iodo-2-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide (PubChem CID 55688233) has the molecular formula C20H17FIN3O and a molecular weight of 461.28 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-(4-iodo-2-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-(4-iodo-2-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55688233 |
| Molecular Formula | C20H17FIN3O |
| Molecular Weight | 461.28 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 1-(2-fluorophenyl)-N-(4-iodo-2-methylphenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)c1nn(-c2ccccc2F)c2c1CCC2 |
| InChI | InChI=1S/C20H17FIN3O/c1-12-11-13(22)9-10-16(12)23-20(26)19-14-5-4-8-17(14)25(24-19)18-7-3-2-6-15(18)21/h2-3,6-7,9-11H,4-5,8H2,1H3,(H,23,26) |
| InChIKey | QXWBHRSXTNEJBV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.28 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|