C21H19N3O3 — CID 166343920
N-(1-benzylindol-3-yl)-2,6-dioxopiperidine-4-carboxamide (PubChem CID 166343920) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is N-(1-benzylindol-3-yl)-2,6-dioxopiperidine-4-carboxamide.
| Compound Name | N-(1-benzylindol-3-yl)-2,6-dioxopiperidine-4-carboxamide |
|---|---|
| PubChem CID | 166343920 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-(1-benzylindol-3-yl)-2,6-dioxopiperidine-4-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2cn(Cc3ccccc3)c3ccccc23)CC(=O)N1 |
| InChI | InChI=1S/C21H19N3O3/c25-19-10-15(11-20(26)23-19)21(27)22-17-13-24(12-14-6-2-1-3-7-14)18-9-5-4-8-16(17)18/h1-9,13,15H,10-12H2,(H,22,27)(H,23,25,26) |
| InChIKey | CDVWHLMYPIRZAU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|