C25H22BrF2N3O6S — CID 166345126
3-[4-(4-bromo-2-fluorophenyl)piperidine-1-carbonyl]-4-fluoro-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide (PubChem CID 166345126) has the molecular formula C25H22BrF2N3O6S and a molecular weight of 610.43 g/mol. Its IUPAC name is 3-[4-(4-bromo-2-fluorophenyl)piperidine-1-carbonyl]-4-fluoro-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide.
| Compound Name | 3-[4-(4-bromo-2-fluorophenyl)piperidine-1-carbonyl]-4-fluoro-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 166345126 |
| Molecular Formula | C25H22BrF2N3O6S |
| Molecular Weight | 610.43 g/mol |
| Exact Mass | 609.04 |
| IUPAC Name | 3-[4-(4-bromo-2-fluorophenyl)piperidine-1-carbonyl]-4-fluoro-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NS(=O)(=O)c1ccc(F)c(C(=O)N2CCC(c3ccc(Br)cc3F)CC2)c1 |
| InChI | InChI=1S/C25H22BrF2N3O6S/c1-37-24-7-3-17(31(33)34)13-23(24)29-38(35,36)18-4-6-21(27)20(14-18)25(32)30-10-8-15(9-11-30)19-5-2-16(26)12-22(19)28/h2-7,12-15,29H,8-11H2,1H3 |
| InChIKey | WYYXCYHSQRORKV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|