C33H39ClN2O5S — CID 166345710
[1-(4-chlorophenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-[1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidin-4-yl]methanone (PubChem CID 166345710) has the molecular formula C33H39ClN2O5S and a molecular weight of 611.20 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-[1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidin-4-yl]methanone.
| Compound Name | [1-(4-chlorophenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-[1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidin-4-yl]methanone |
|---|---|
| PubChem CID | 166345710 |
| Molecular Formula | C33H39ClN2O5S |
| Molecular Weight | 611.20 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | [1-(4-chlorophenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-[1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidin-4-yl]methanone |
| SMILES | COc1cc2c(cc1OC)C(c1ccc(Cl)cc1)N(C(=O)C1CCN(S(=O)(=O)c3c(C)c(C)cc(C)c3C)CC1)CC2 |
| InChI | InChI=1S/C33H39ClN2O5S/c1-20-17-21(2)23(4)32(22(20)3)42(38,39)35-14-11-25(12-15-35)33(37)36-16-13-26-18-29(40-5)30(41-6)19-28(26)31(36)24-7-9-27(34)10-8-24/h7-10,17-19,25,31H,11-16H2,1-6H3 |
| InChIKey | SOTSUNUEFINSJV-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.20 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |