C31H33Cl2N3O5S — CID 166345773
N-[2-(3,5-dichlorophenoxy)-5-piperidin-1-ylsulfonylphenyl]-2-[2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-2-oxoacetamide (PubChem CID 166345773) has the molecular formula C31H33Cl2N3O5S and a molecular weight of 630.59 g/mol. Its IUPAC name is N-[2-(3,5-dichlorophenoxy)-5-piperidin-1-ylsulfonylphenyl]-2-[2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-2-oxoacetamide.
| Compound Name | N-[2-(3,5-dichlorophenoxy)-5-piperidin-1-ylsulfonylphenyl]-2-[2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 166345773 |
| Molecular Formula | C31H33Cl2N3O5S |
| Molecular Weight | 630.59 g/mol |
| Exact Mass | 629.15 |
| IUPAC Name | N-[2-(3,5-dichlorophenoxy)-5-piperidin-1-ylsulfonylphenyl]-2-[2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]-2-oxoacetamide |
| SMILES | Cc1ccccc1C1CC(C)N(C(=O)C(=O)Nc2cc(S(=O)(=O)N3CCCCC3)ccc2Oc2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C31H33Cl2N3O5S/c1-20-8-4-5-9-27(20)22-14-21(2)36(19-22)31(38)30(37)34-28-18-26(42(39,40)35-12-6-3-7-13-35)10-11-29(28)41-25-16-23(32)15-24(33)17-25/h4-5,8-11,15-18,21-22H,3,6-7,12-14,19H2,1-2H3,(H,34,37) |
| InChIKey | IPSMWMADFJVTBG-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.59 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|